About 3-methyl-5-[(1-methylimidazol-4-yl)sulfonylamino]-1,2-thiazole-4-carboxylic acid
3-methyl-5-[(1-methylimidazol-4-yl)sulfonylamino]-1,2-thiazole-4-carboxylic acid (PubChem CID 62373942) has the molecular formula C9H10N4O4S2
and a molecular weight of 302.34 g/mol. Its IUPAC name is 3-methyl-5-[(1-methylimidazol-4-yl)sulfonylamino]-1,2-thiazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 3-methyl-5-[(1-methylimidazol-4-yl)sulfonylamino]-1,2-thiazole-4-carboxylic acid |
| PubChem CID | 62373942 |
| Molecular Formula | C9H10N4O4S2 |
| Molecular Weight | 302.34 g/mol |
| Exact Mass | 302.01 |
| IUPAC Name | 3-methyl-5-[(1-methylimidazol-4-yl)sulfonylamino]-1,2-thiazole-4-carboxylic acid |
| SMILES | Cc1nsc(NS(=O)(=O)c2cn(C)cn2)c1C(=O)O |
| InChI | InChI=1S/C9H10N4O4S2/c1-5-7(9(14)15)8(18-11-5)12-19(16,17)6-3-13(2)4-10-6/h3-4,12H,1-2H3,(H,14,15) |
| InChIKey | FKFFLFLYQYFIAE-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.34 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-methyl-5-[(1-methylimidazol-4-yl)sulfonylamino]-1,2-thiazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-5-[(1-methylimidazol-4-yl)sulfonylamino]-1,2-thiazole-4-carboxylic acid?
The IUPAC name of 3-methyl-5-[(1-methylimidazol-4-yl)sulfonylamino]-1,2-thiazole-4-carboxylic acid (CID 62373942) is 3-methyl-5-[(1-methylimidazol-4-yl)sulfonylamino]-1,2-thiazole-4-carboxylic acid.
What is the SMILES notation for 3-methyl-5-[(1-methylimidazol-4-yl)sulfonylamino]-1,2-thiazole-4-carboxylic acid?
The canonical SMILES for 3-methyl-5-[(1-methylimidazol-4-yl)sulfonylamino]-1,2-thiazole-4-carboxylic acid is Cc1nsc(NS(=O)(=O)c2cn(C)cn2)c1C(=O)O.
What is the InChIKey of 3-methyl-5-[(1-methylimidazol-4-yl)sulfonylamino]-1,2-thiazole-4-carboxylic acid?
The InChIKey is FKFFLFLYQYFIAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4O4S2/c1-5-7(9(14)15)8(18-11-5)12-19(16,17)6-3-13(2)4-10-6/h3-4,12H,1-2H3,(H,14,15).
What are the key properties of 3-methyl-5-[(1-methylimidazol-4-yl)sulfonylamino]-1,2-thiazole-4-carboxylic acid?
3-methyl-5-[(1-methylimidazol-4-yl)sulfonylamino]-1,2-thiazole-4-carboxylic acid has a molecular weight of 302.34 g/mol, XLogP of 0.68, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-5-[(1-methylimidazol-4-yl)sulfonylamino]-1,2-thiazole-4-carboxylic acid is sourced from PubChem (CID 62373942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).