C10H11Cl2N — CID 62374580
5,7-dichloro-3-methyl-1,2,3,4-tetrahydroisoquinoline (PubChem CID 62374580) has the molecular formula C10H11Cl2N and a molecular weight of 216.11 g/mol. Its IUPAC name is 5,7-dichloro-3-methyl-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 5,7-dichloro-3-methyl-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 62374580 |
| Molecular Formula | C10H11Cl2N |
| Molecular Weight | 216.11 g/mol |
| Exact Mass | 215.03 |
| IUPAC Name | 5,7-dichloro-3-methyl-1,2,3,4-tetrahydroisoquinoline |
| SMILES | CC1Cc2c(Cl)cc(Cl)cc2CN1 |
| InChI | InChI=1S/C10H11Cl2N/c1-6-2-9-7(5-13-6)3-8(11)4-10(9)12/h3-4,6,13H,2,5H2,1H3 |
| InChIKey | XSXYXPZBRQKLLP-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.11 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |