C15H18F3N3O4S — CID 623750
methyl 2-acetamido-2-[(3-carbamoyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-3,3,3-trifluoropropanoate (PubChem CID 623750) has the molecular formula C15H18F3N3O4S and a molecular weight of 393.39 g/mol. Its IUPAC name is methyl 2-acetamido-2-[(3-carbamoyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-3,3,3-trifluoropropanoate.
| Compound Name | methyl 2-acetamido-2-[(3-carbamoyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-3,3,3-trifluoropropanoate |
|---|---|
| PubChem CID | 623750 |
| Molecular Formula | C15H18F3N3O4S |
| Molecular Weight | 393.39 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | methyl 2-acetamido-2-[(3-carbamoyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-3,3,3-trifluoropropanoate |
| SMILES | COC(=O)C(NC(C)=O)(Nc1sc2c(c1C(N)=O)CCCC2)C(F)(F)F |
| InChI | InChI=1S/C15H18F3N3O4S/c1-7(22)20-14(13(24)25-2,15(16,17)18)21-12-10(11(19)23)8-5-3-4-6-9(8)26-12/h21H,3-6H2,1-2H3,(H2,19,23)(H,20,22) |
| InChIKey | IXYQEUBKTJRCKI-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.39 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|