C10H9Cl2N3O4S2 — CID 62375451
3-chloro-4-[(1-methylimidazol-4-yl)sulfonylamino]benzenesulfonyl chloride (PubChem CID 62375451) has the molecular formula C10H9Cl2N3O4S2 and a molecular weight of 370.24 g/mol. Its IUPAC name is 3-chloro-4-[(1-methylimidazol-4-yl)sulfonylamino]benzenesulfonyl chloride.
| Compound Name | 3-chloro-4-[(1-methylimidazol-4-yl)sulfonylamino]benzenesulfonyl chloride |
|---|---|
| PubChem CID | 62375451 |
| Molecular Formula | C10H9Cl2N3O4S2 |
| Molecular Weight | 370.24 g/mol |
| Exact Mass | 368.94 |
| IUPAC Name | 3-chloro-4-[(1-methylimidazol-4-yl)sulfonylamino]benzenesulfonyl chloride |
| SMILES | Cn1cnc(S(=O)(=O)Nc2ccc(S(=O)(=O)Cl)cc2Cl)c1 |
| InChI | InChI=1S/C10H9Cl2N3O4S2/c1-15-5-10(13-6-15)21(18,19)14-9-3-2-7(4-8(9)11)20(12,16)17/h2-6,14H,1H3 |
| InChIKey | OUZOZFICBWRTQD-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 98.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.24 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |