C13H18FN3O3 — CID 62376068
N,N-diethyl-3-(5-fluoro-2-nitroanilino)propanamide (PubChem CID 62376068) has the molecular formula C13H18FN3O3 and a molecular weight of 283.30 g/mol. Its IUPAC name is N,N-diethyl-3-(5-fluoro-2-nitroanilino)propanamide.
| Compound Name | N,N-diethyl-3-(5-fluoro-2-nitroanilino)propanamide |
|---|---|
| PubChem CID | 62376068 |
| Molecular Formula | C13H18FN3O3 |
| Molecular Weight | 283.30 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | N,N-diethyl-3-(5-fluoro-2-nitroanilino)propanamide |
| SMILES | CCN(CC)C(=O)CCNc1cc(F)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H18FN3O3/c1-3-16(4-2)13(18)7-8-15-11-9-10(14)5-6-12(11)17(19)20/h5-6,9,15H,3-4,7-8H2,1-2H3 |
| InChIKey | BGRVMGIDTRQYDB-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.30 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|