C15H17ClFN3 — CID 62376357
2-(chloromethyl)-6-fluoro-1-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl)benzimidazole (PubChem CID 62376357) has the molecular formula C15H17ClFN3 and a molecular weight of 293.77 g/mol. Its IUPAC name is 2-(chloromethyl)-6-fluoro-1-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl)benzimidazole.
| Compound Name | 2-(chloromethyl)-6-fluoro-1-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl)benzimidazole |
|---|---|
| PubChem CID | 62376357 |
| Molecular Formula | C15H17ClFN3 |
| Molecular Weight | 293.77 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | 2-(chloromethyl)-6-fluoro-1-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl)benzimidazole |
| SMILES | Fc1ccc2nc(CCl)n(C3CCN4CCCC34)c2c1 |
| InChI | InChI=1S/C15H17ClFN3/c16-9-15-18-11-4-3-10(17)8-14(11)20(15)13-5-7-19-6-1-2-12(13)19/h3-4,8,12-13H,1-2,5-7,9H2 |
| InChIKey | WCXAEGIEWBOZBV-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.77 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|