C16H13FN2 — CID 62376460
4-fluoro-2-N-naphthalen-2-ylbenzene-1,2-diamine (PubChem CID 62376460) has the molecular formula C16H13FN2 and a molecular weight of 252.29 g/mol. Its IUPAC name is 4-fluoro-2-N-naphthalen-2-ylbenzene-1,2-diamine.
| Compound Name | 4-fluoro-2-N-naphthalen-2-ylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 62376460 |
| Molecular Formula | C16H13FN2 |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | 4-fluoro-2-N-naphthalen-2-ylbenzene-1,2-diamine |
| SMILES | Nc1ccc(F)cc1Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C16H13FN2/c17-13-6-8-15(18)16(10-13)19-14-7-5-11-3-1-2-4-12(11)9-14/h1-10,19H,18H2 |
| InChIKey | KEZFZLKELUMOHM-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|