C16H16ClFN2S — CID 62378429
2-(chloromethyl)-6-fluoro-1-(1-thiophen-2-ylbutyl)benzimidazole (PubChem CID 62378429) has the molecular formula C16H16ClFN2S and a molecular weight of 322.84 g/mol. Its IUPAC name is 2-(chloromethyl)-6-fluoro-1-(1-thiophen-2-ylbutyl)benzimidazole.
| Compound Name | 2-(chloromethyl)-6-fluoro-1-(1-thiophen-2-ylbutyl)benzimidazole |
|---|---|
| PubChem CID | 62378429 |
| Molecular Formula | C16H16ClFN2S |
| Molecular Weight | 322.84 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | 2-(chloromethyl)-6-fluoro-1-(1-thiophen-2-ylbutyl)benzimidazole |
| SMILES | CCCC(c1cccs1)n1c(CCl)nc2ccc(F)cc21 |
| InChI | InChI=1S/C16H16ClFN2S/c1-2-4-13(15-5-3-8-21-15)20-14-9-11(18)6-7-12(14)19-16(20)10-17/h3,5-9,13H,2,4,10H2,1H3 |
| InChIKey | BZBLKWSOMIUWJB-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.84 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|