About 2-(2,3,4-trifluorophenyl)guanidine
2-(2,3,4-trifluorophenyl)guanidine (PubChem CID 62379829) has the molecular formula C7H6F3N3
and a molecular weight of 189.14 g/mol. Its IUPAC name is 2-(2,3,4-trifluorophenyl)guanidine.
Molecular Properties
| Compound Name | 2-(2,3,4-trifluorophenyl)guanidine |
| PubChem CID | 62379829 |
| Molecular Formula | C7H6F3N3 |
| Molecular Weight | 189.14 g/mol |
| Exact Mass | 189.05 |
| IUPAC Name | 2-(2,3,4-trifluorophenyl)guanidine |
| SMILES | NC(N)=Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C7H6F3N3/c8-3-1-2-4(13-7(11)12)6(10)5(3)9/h1-2H,(H4,11,12,13) |
| InChIKey | BKINSITVUMPGMC-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.14 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,3,4-trifluorophenyl)guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,3,4-trifluorophenyl)guanidine?
The IUPAC name of 2-(2,3,4-trifluorophenyl)guanidine (CID 62379829) is 2-(2,3,4-trifluorophenyl)guanidine.
What is the SMILES notation for 2-(2,3,4-trifluorophenyl)guanidine?
The canonical SMILES for 2-(2,3,4-trifluorophenyl)guanidine is NC(N)=Nc1ccc(F)c(F)c1F.
What is the InChIKey of 2-(2,3,4-trifluorophenyl)guanidine?
The InChIKey is BKINSITVUMPGMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6F3N3/c8-3-1-2-4(13-7(11)12)6(10)5(3)9/h1-2H,(H4,11,12,13).
What are the key properties of 2-(2,3,4-trifluorophenyl)guanidine?
2-(2,3,4-trifluorophenyl)guanidine has a molecular weight of 189.14 g/mol, XLogP of 1.01, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3,4-trifluorophenyl)guanidine is sourced from PubChem (CID 62379829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).