C11H15F2NO — CID 62380605
N-(2,2-difluoroethyl)-3-phenoxypropan-1-amine (PubChem CID 62380605) has the molecular formula C11H15F2NO and a molecular weight of 215.24 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-3-phenoxypropan-1-amine.
| Compound Name | N-(2,2-difluoroethyl)-3-phenoxypropan-1-amine |
|---|---|
| PubChem CID | 62380605 |
| Molecular Formula | C11H15F2NO |
| Molecular Weight | 215.24 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | N-(2,2-difluoroethyl)-3-phenoxypropan-1-amine |
| SMILES | FC(F)CNCCCOc1ccccc1 |
| InChI | InChI=1S/C11H15F2NO/c12-11(13)9-14-7-4-8-15-10-5-2-1-3-6-10/h1-3,5-6,11,14H,4,7-9H2 |
| InChIKey | JIMQZZZWEHDLDG-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.24 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|