About N-(2-methoxyethyl)-N'-methyl-N'-prop-2-enylethane-1,2-diamine
N-(2-methoxyethyl)-N'-methyl-N'-prop-2-enylethane-1,2-diamine (PubChem CID 62381598) has the molecular formula C9H20N2O
and a molecular weight of 172.27 g/mol. Its IUPAC name is N-(2-methoxyethyl)-N'-methyl-N'-prop-2-enylethane-1,2-diamine.
Molecular Properties
| Compound Name | N-(2-methoxyethyl)-N'-methyl-N'-prop-2-enylethane-1,2-diamine |
| PubChem CID | 62381598 |
| Molecular Formula | C9H20N2O |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.16 |
| IUPAC Name | N-(2-methoxyethyl)-N'-methyl-N'-prop-2-enylethane-1,2-diamine |
| SMILES | C=CCN(C)CCNCCOC |
| InChI | InChI=1S/C9H20N2O/c1-4-7-11(2)8-5-10-6-9-12-3/h4,10H,1,5-9H2,2-3H3 |
| InChIKey | GSXDNDOQRDJXEF-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-(2-methoxyethyl)-N'-methyl-N'-prop-2-enylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-methoxyethyl)-N'-methyl-N'-prop-2-enylethane-1,2-diamine?
The IUPAC name of N-(2-methoxyethyl)-N'-methyl-N'-prop-2-enylethane-1,2-diamine (CID 62381598) is N-(2-methoxyethyl)-N'-methyl-N'-prop-2-enylethane-1,2-diamine.
What is the SMILES notation for N-(2-methoxyethyl)-N'-methyl-N'-prop-2-enylethane-1,2-diamine?
The canonical SMILES for N-(2-methoxyethyl)-N'-methyl-N'-prop-2-enylethane-1,2-diamine is C=CCN(C)CCNCCOC.
What is the InChIKey of N-(2-methoxyethyl)-N'-methyl-N'-prop-2-enylethane-1,2-diamine?
The InChIKey is GSXDNDOQRDJXEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N2O/c1-4-7-11(2)8-5-10-6-9-12-3/h4,10H,1,5-9H2,2-3H3.
What are the key properties of N-(2-methoxyethyl)-N'-methyl-N'-prop-2-enylethane-1,2-diamine?
N-(2-methoxyethyl)-N'-methyl-N'-prop-2-enylethane-1,2-diamine has a molecular weight of 172.27 g/mol, XLogP of 0.34, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-methoxyethyl)-N'-methyl-N'-prop-2-enylethane-1,2-diamine is sourced from PubChem (CID 62381598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).