C16H25NO3 — CID 62382373
1-(2-aminophenoxy)-3-(cyclohexylmethoxy)propan-2-ol (PubChem CID 62382373) has the molecular formula C16H25NO3 and a molecular weight of 279.38 g/mol. Its IUPAC name is 1-(2-aminophenoxy)-3-(cyclohexylmethoxy)propan-2-ol.
| Compound Name | 1-(2-aminophenoxy)-3-(cyclohexylmethoxy)propan-2-ol |
|---|---|
| PubChem CID | 62382373 |
| Molecular Formula | C16H25NO3 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | 1-(2-aminophenoxy)-3-(cyclohexylmethoxy)propan-2-ol |
| SMILES | Nc1ccccc1OCC(O)COCC1CCCCC1 |
| InChI | InChI=1S/C16H25NO3/c17-15-8-4-5-9-16(15)20-12-14(18)11-19-10-13-6-2-1-3-7-13/h4-5,8-9,13-14,18H,1-3,6-7,10-12,17H2 |
| InChIKey | JCUJMOUZXRTWHO-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|