C16H22O3 — CID 62382456
1-(2,5-dimethylphenyl)-2-(oxan-4-ylmethoxy)ethanone (PubChem CID 62382456) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)-2-(oxan-4-ylmethoxy)ethanone.
| Compound Name | 1-(2,5-dimethylphenyl)-2-(oxan-4-ylmethoxy)ethanone |
|---|---|
| PubChem CID | 62382456 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | 1-(2,5-dimethylphenyl)-2-(oxan-4-ylmethoxy)ethanone |
| SMILES | Cc1ccc(C)c(C(=O)COCC2CCOCC2)c1 |
| InChI | InChI=1S/C16H22O3/c1-12-3-4-13(2)15(9-12)16(17)11-19-10-14-5-7-18-8-6-14/h3-4,9,14H,5-8,10-11H2,1-2H3 |
| InChIKey | WRJJBGWCKLHFIB-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |