C26H29Cl2N3O6S — CID 6238368
4-[(Z)-[2-(3,4-dichlorophenyl)-1-(3-morpholin-4-ylpropyl)-4,5-dioxopyrrolidin-3-ylidene]-hydroxymethyl]-N,N-dimethylbenzenesulfonamide (PubChem CID 6238368) has the molecular formula C26H29Cl2N3O6S and a molecular weight of 582.51 g/mol. Its IUPAC name is 4-[(Z)-[2-(3,4-dichlorophenyl)-1-(3-morpholin-4-ylpropyl)-4,5-dioxopyrrolidin-3-ylidene]-hydroxymethyl]-N,N-dimethylbenzenesulfonamide.
| Compound Name | 4-[(Z)-[2-(3,4-dichlorophenyl)-1-(3-morpholin-4-ylpropyl)-4,5-dioxopyrrolidin-3-ylidene]-hydroxymethyl]-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 6238368 |
| Molecular Formula | C26H29Cl2N3O6S |
| Molecular Weight | 582.51 g/mol |
| Exact Mass | 581.12 |
| IUPAC Name | 4-[(Z)-[2-(3,4-dichlorophenyl)-1-(3-morpholin-4-ylpropyl)-4,5-dioxopyrrolidin-3-ylidene]-hydroxymethyl]-N,N-dimethylbenzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(/C(O)=C2/C(=O)C(=O)N(CCCN3CCOCC3)C2c2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C26H29Cl2N3O6S/c1-29(2)38(35,36)19-7-4-17(5-8-19)24(32)22-23(18-6-9-20(27)21(28)16-18)31(26(34)25(22)33)11-3-10-30-12-14-37-15-13-30/h4-9,16,23,32H,3,10-15H2,1-2H3/b24-22- |
| InChIKey | DIFVEQSJKFFDFM-GYHWCHFESA-N |
| XLogP | 3.39 |
| TPSA | 107.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.51 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|