About 3-(cyclohexylmethoxy)-4,4,4-trifluorobutan-1-amine
3-(cyclohexylmethoxy)-4,4,4-trifluorobutan-1-amine (PubChem CID 62383874) has the molecular formula C11H20F3NO
and a molecular weight of 239.28 g/mol. Its IUPAC name is 3-(cyclohexylmethoxy)-4,4,4-trifluorobutan-1-amine.
Molecular Properties
| Compound Name | 3-(cyclohexylmethoxy)-4,4,4-trifluorobutan-1-amine |
| PubChem CID | 62383874 |
| Molecular Formula | C11H20F3NO |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 3-(cyclohexylmethoxy)-4,4,4-trifluorobutan-1-amine |
| SMILES | NCCC(OCC1CCCCC1)C(F)(F)F |
| InChI | InChI=1S/C11H20F3NO/c12-11(13,14)10(6-7-15)16-8-9-4-2-1-3-5-9/h9-10H,1-8,15H2 |
| InChIKey | BCPDGWURGICFNU-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(cyclohexylmethoxy)-4,4,4-trifluorobutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(cyclohexylmethoxy)-4,4,4-trifluorobutan-1-amine?
The IUPAC name of 3-(cyclohexylmethoxy)-4,4,4-trifluorobutan-1-amine (CID 62383874) is 3-(cyclohexylmethoxy)-4,4,4-trifluorobutan-1-amine.
What is the SMILES notation for 3-(cyclohexylmethoxy)-4,4,4-trifluorobutan-1-amine?
The canonical SMILES for 3-(cyclohexylmethoxy)-4,4,4-trifluorobutan-1-amine is NCCC(OCC1CCCCC1)C(F)(F)F.
What is the InChIKey of 3-(cyclohexylmethoxy)-4,4,4-trifluorobutan-1-amine?
The InChIKey is BCPDGWURGICFNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20F3NO/c12-11(13,14)10(6-7-15)16-8-9-4-2-1-3-5-9/h9-10H,1-8,15H2.
What are the key properties of 3-(cyclohexylmethoxy)-4,4,4-trifluorobutan-1-amine?
3-(cyclohexylmethoxy)-4,4,4-trifluorobutan-1-amine has a molecular weight of 239.28 g/mol, XLogP of 2.86, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(cyclohexylmethoxy)-4,4,4-trifluorobutan-1-amine is sourced from PubChem (CID 62383874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).