About ethyl oxane-4-carboximidate
ethyl oxane-4-carboximidate (PubChem CID 62384649) has the molecular formula C8H15NO2
and a molecular weight of 157.21 g/mol. Its IUPAC name is ethyl oxane-4-carboximidate.
Molecular Properties
| Compound Name | ethyl oxane-4-carboximidate |
| PubChem CID | 62384649 |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.11 |
| IUPAC Name | ethyl oxane-4-carboximidate |
| SMILES | [H]/N=C(\OCC)C1CCOCC1 |
| InChI | InChI=1S/C8H15NO2/c1-2-11-8(9)7-3-5-10-6-4-7/h7,9H,2-6H2,1H3/b9-8- |
| InChIKey | BWDPTIYUGYJUAU-HJWRWDBZSA-N |
| XLogP | 1.43 |
| TPSA | 42.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.21 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze ethyl oxane-4-carboximidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl oxane-4-carboximidate?
The IUPAC name of ethyl oxane-4-carboximidate (CID 62384649) is ethyl oxane-4-carboximidate.
What is the SMILES notation for ethyl oxane-4-carboximidate?
The canonical SMILES for ethyl oxane-4-carboximidate is [H]/N=C(\OCC)C1CCOCC1.
What is the InChIKey of ethyl oxane-4-carboximidate?
The InChIKey is BWDPTIYUGYJUAU-HJWRWDBZSA-N. The full InChI is InChI=1S/C8H15NO2/c1-2-11-8(9)7-3-5-10-6-4-7/h7,9H,2-6H2,1H3/b9-8-.
What are the key properties of ethyl oxane-4-carboximidate?
ethyl oxane-4-carboximidate has a molecular weight of 157.21 g/mol, XLogP of 1.43, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl oxane-4-carboximidate is sourced from PubChem (CID 62384649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).