About 4-(3-bromopentyl)oxane
4-(3-bromopentyl)oxane (PubChem CID 62385358) has the molecular formula C10H19BrO
and a molecular weight of 235.16 g/mol. Its IUPAC name is 4-(3-bromopentyl)oxane.
Molecular Properties
| Compound Name | 4-(3-bromopentyl)oxane |
| PubChem CID | 62385358 |
| Molecular Formula | C10H19BrO |
| Molecular Weight | 235.16 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | 4-(3-bromopentyl)oxane |
| SMILES | CCC(Br)CCC1CCOCC1 |
| InChI | InChI=1S/C10H19BrO/c1-2-10(11)4-3-9-5-7-12-8-6-9/h9-10H,2-8H2,1H3 |
| InChIKey | REJRALRZBSDEJG-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.16 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(3-bromopentyl)oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-bromopentyl)oxane?
The IUPAC name of 4-(3-bromopentyl)oxane (CID 62385358) is 4-(3-bromopentyl)oxane.
What is the SMILES notation for 4-(3-bromopentyl)oxane?
The canonical SMILES for 4-(3-bromopentyl)oxane is CCC(Br)CCC1CCOCC1.
What is the InChIKey of 4-(3-bromopentyl)oxane?
The InChIKey is REJRALRZBSDEJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19BrO/c1-2-10(11)4-3-9-5-7-12-8-6-9/h9-10H,2-8H2,1H3.
What are the key properties of 4-(3-bromopentyl)oxane?
4-(3-bromopentyl)oxane has a molecular weight of 235.16 g/mol, XLogP of 3.37, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-bromopentyl)oxane is sourced from PubChem (CID 62385358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).