C15H20N4O — CID 62386703
3-(5-methyl-1H-1,2,4-triazol-3-yl)-N-(oxan-4-ylmethyl)aniline (PubChem CID 62386703) has the molecular formula C15H20N4O and a molecular weight of 272.35 g/mol. Its IUPAC name is 3-(5-methyl-1H-1,2,4-triazol-3-yl)-N-(oxan-4-ylmethyl)aniline.
| Compound Name | 3-(5-methyl-1H-1,2,4-triazol-3-yl)-N-(oxan-4-ylmethyl)aniline |
|---|---|
| PubChem CID | 62386703 |
| Molecular Formula | C15H20N4O |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | 3-(5-methyl-1H-1,2,4-triazol-3-yl)-N-(oxan-4-ylmethyl)aniline |
| SMILES | Cc1nc(-c2cccc(NCC3CCOCC3)c2)n[nH]1 |
| InChI | InChI=1S/C15H20N4O/c1-11-17-15(19-18-11)13-3-2-4-14(9-13)16-10-12-5-7-20-8-6-12/h2-4,9,12,16H,5-8,10H2,1H3,(H,17,18,19) |
| InChIKey | KWKIGIYYDMIRFR-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |