About 2-(oxan-4-yl)-1,3-thiazolidine
2-(oxan-4-yl)-1,3-thiazolidine (PubChem CID 62387035) has the molecular formula C8H15NOS
and a molecular weight of 173.28 g/mol. Its IUPAC name is 2-(oxan-4-yl)-1,3-thiazolidine.
Molecular Properties
| Compound Name | 2-(oxan-4-yl)-1,3-thiazolidine |
| PubChem CID | 62387035 |
| Molecular Formula | C8H15NOS |
| Molecular Weight | 173.28 g/mol |
| Exact Mass | 173.09 |
| IUPAC Name | 2-(oxan-4-yl)-1,3-thiazolidine |
| SMILES | C1CSC(C2CCOCC2)N1 |
| InChI | InChI=1S/C8H15NOS/c1-4-10-5-2-7(1)8-9-3-6-11-8/h7-9H,1-6H2 |
| InChIKey | ARGUAIACVIDRKI-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.28 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(oxan-4-yl)-1,3-thiazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(oxan-4-yl)-1,3-thiazolidine?
The IUPAC name of 2-(oxan-4-yl)-1,3-thiazolidine (CID 62387035) is 2-(oxan-4-yl)-1,3-thiazolidine.
What is the SMILES notation for 2-(oxan-4-yl)-1,3-thiazolidine?
The canonical SMILES for 2-(oxan-4-yl)-1,3-thiazolidine is C1CSC(C2CCOCC2)N1.
What is the InChIKey of 2-(oxan-4-yl)-1,3-thiazolidine?
The InChIKey is ARGUAIACVIDRKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NOS/c1-4-10-5-2-7(1)8-9-3-6-11-8/h7-9H,1-6H2.
What are the key properties of 2-(oxan-4-yl)-1,3-thiazolidine?
2-(oxan-4-yl)-1,3-thiazolidine has a molecular weight of 173.28 g/mol, XLogP of 1.08, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(oxan-4-yl)-1,3-thiazolidine is sourced from PubChem (CID 62387035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).