C8H15N5O — CID 62387046
1-(oxan-4-yl)-N-(2H-tetrazol-5-ylmethyl)methanamine (PubChem CID 62387046) has the molecular formula C8H15N5O and a molecular weight of 197.24 g/mol. Its IUPAC name is 1-(oxan-4-yl)-N-(2H-tetrazol-5-ylmethyl)methanamine.
| Compound Name | 1-(oxan-4-yl)-N-(2H-tetrazol-5-ylmethyl)methanamine |
|---|---|
| PubChem CID | 62387046 |
| Molecular Formula | C8H15N5O |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.13 |
| IUPAC Name | 1-(oxan-4-yl)-N-(2H-tetrazol-5-ylmethyl)methanamine |
| SMILES | C1CC(CNCc2nn[nH]n2)CCO1 |
| InChI | InChI=1S/C8H15N5O/c1-3-14-4-2-7(1)5-9-6-8-10-12-13-11-8/h7,9H,1-6H2,(H,10,11,12,13) |
| InChIKey | HWYXTFNDJINLHG-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |