C16H23NO2 — CID 62387152
2-methyl-8-(oxan-4-ylmethoxy)-1,2,3,4-tetrahydroquinoline (PubChem CID 62387152) has the molecular formula C16H23NO2 and a molecular weight of 261.36 g/mol. Its IUPAC name is 2-methyl-8-(oxan-4-ylmethoxy)-1,2,3,4-tetrahydroquinoline.
| Compound Name | 2-methyl-8-(oxan-4-ylmethoxy)-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 62387152 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.36 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | 2-methyl-8-(oxan-4-ylmethoxy)-1,2,3,4-tetrahydroquinoline |
| SMILES | CC1CCc2cccc(OCC3CCOCC3)c2N1 |
| InChI | InChI=1S/C16H23NO2/c1-12-5-6-14-3-2-4-15(16(14)17-12)19-11-13-7-9-18-10-8-13/h2-4,12-13,17H,5-11H2,1H3 |
| InChIKey | HYTNRWDHHGNSMW-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.36 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |