About 1-(oxan-4-yl)pentane-1,4-dione
1-(oxan-4-yl)pentane-1,4-dione (PubChem CID 62387198) has the molecular formula C10H16O3
and a molecular weight of 184.23 g/mol. Its IUPAC name is 1-(oxan-4-yl)pentane-1,4-dione.
Molecular Properties
| Compound Name | 1-(oxan-4-yl)pentane-1,4-dione |
| PubChem CID | 62387198 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | 1-(oxan-4-yl)pentane-1,4-dione |
| SMILES | CC(=O)CCC(=O)C1CCOCC1 |
| InChI | InChI=1S/C10H16O3/c1-8(11)2-3-10(12)9-4-6-13-7-5-9/h9H,2-7H2,1H3 |
| InChIKey | GJOXBRSPNLBAJO-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(oxan-4-yl)pentane-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(oxan-4-yl)pentane-1,4-dione?
The IUPAC name of 1-(oxan-4-yl)pentane-1,4-dione (CID 62387198) is 1-(oxan-4-yl)pentane-1,4-dione.
What is the SMILES notation for 1-(oxan-4-yl)pentane-1,4-dione?
The canonical SMILES for 1-(oxan-4-yl)pentane-1,4-dione is CC(=O)CCC(=O)C1CCOCC1.
What is the InChIKey of 1-(oxan-4-yl)pentane-1,4-dione?
The InChIKey is GJOXBRSPNLBAJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O3/c1-8(11)2-3-10(12)9-4-6-13-7-5-9/h9H,2-7H2,1H3.
What are the key properties of 1-(oxan-4-yl)pentane-1,4-dione?
1-(oxan-4-yl)pentane-1,4-dione has a molecular weight of 184.23 g/mol, XLogP of 1.35, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(oxan-4-yl)pentane-1,4-dione is sourced from PubChem (CID 62387198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).