About 6-amino-1,1-dioxo-2-(2-pyrazol-1-ylethyl)-1,2-benzothiazol-3-one
6-amino-1,1-dioxo-2-(2-pyrazol-1-ylethyl)-1,2-benzothiazol-3-one (PubChem CID 62388646) has the molecular formula C12H12N4O3S
and a molecular weight of 292.32 g/mol. Its IUPAC name is 6-amino-1,1-dioxo-2-(2-pyrazol-1-ylethyl)-1,2-benzothiazol-3-one.
Molecular Properties
| Compound Name | 6-amino-1,1-dioxo-2-(2-pyrazol-1-ylethyl)-1,2-benzothiazol-3-one |
| PubChem CID | 62388646 |
| Molecular Formula | C12H12N4O3S |
| Molecular Weight | 292.32 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | 6-amino-1,1-dioxo-2-(2-pyrazol-1-ylethyl)-1,2-benzothiazol-3-one |
| SMILES | Nc1ccc2c(c1)S(=O)(=O)N(CCn1cccn1)C2=O |
| InChI | InChI=1S/C12H12N4O3S/c13-9-2-3-10-11(8-9)20(18,19)16(12(10)17)7-6-15-5-1-4-14-15/h1-5,8H,6-7,13H2 |
| InChIKey | ORKKRUIRWONXMM-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 98.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.32 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 6-amino-1,1-dioxo-2-(2-pyrazol-1-ylethyl)-1,2-benzothiazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-1,1-dioxo-2-(2-pyrazol-1-ylethyl)-1,2-benzothiazol-3-one?
The IUPAC name of 6-amino-1,1-dioxo-2-(2-pyrazol-1-ylethyl)-1,2-benzothiazol-3-one (CID 62388646) is 6-amino-1,1-dioxo-2-(2-pyrazol-1-ylethyl)-1,2-benzothiazol-3-one.
What is the SMILES notation for 6-amino-1,1-dioxo-2-(2-pyrazol-1-ylethyl)-1,2-benzothiazol-3-one?
The canonical SMILES for 6-amino-1,1-dioxo-2-(2-pyrazol-1-ylethyl)-1,2-benzothiazol-3-one is Nc1ccc2c(c1)S(=O)(=O)N(CCn1cccn1)C2=O.
What is the InChIKey of 6-amino-1,1-dioxo-2-(2-pyrazol-1-ylethyl)-1,2-benzothiazol-3-one?
The InChIKey is ORKKRUIRWONXMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N4O3S/c13-9-2-3-10-11(8-9)20(18,19)16(12(10)17)7-6-15-5-1-4-14-15/h1-5,8H,6-7,13H2.
What are the key properties of 6-amino-1,1-dioxo-2-(2-pyrazol-1-ylethyl)-1,2-benzothiazol-3-one?
6-amino-1,1-dioxo-2-(2-pyrazol-1-ylethyl)-1,2-benzothiazol-3-one has a molecular weight of 292.32 g/mol, XLogP of 0.31, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-1,1-dioxo-2-(2-pyrazol-1-ylethyl)-1,2-benzothiazol-3-one is sourced from PubChem (CID 62388646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).