About spiro[1,2-dihydroindene-3,2'-cyclopropane]-1'-amine
spiro[1,2-dihydroindene-3,2'-cyclopropane]-1'-amine (PubChem CID 62388829) has the molecular formula C11H13N
and a molecular weight of 159.23 g/mol. Its IUPAC name is spiro[1,2-dihydroindene-3,2'-cyclopropane]-1'-amine.
Molecular Properties
| Compound Name | spiro[1,2-dihydroindene-3,2'-cyclopropane]-1'-amine |
| PubChem CID | 62388829 |
| Molecular Formula | C11H13N |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.10 |
| IUPAC Name | spiro[1,2-dihydroindene-3,2'-cyclopropane]-1'-amine |
| SMILES | NC1CC12CCc1ccccc12 |
| InChI | InChI=1S/C11H13N/c12-10-7-11(10)6-5-8-3-1-2-4-9(8)11/h1-4,10H,5-7,12H2 |
| InChIKey | SGGAHRNIDLQRJU-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze spiro[1,2-dihydroindene-3,2'-cyclopropane]-1'-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[1,2-dihydroindene-3,2'-cyclopropane]-1'-amine?
The IUPAC name of spiro[1,2-dihydroindene-3,2'-cyclopropane]-1'-amine (CID 62388829) is spiro[1,2-dihydroindene-3,2'-cyclopropane]-1'-amine.
What is the SMILES notation for spiro[1,2-dihydroindene-3,2'-cyclopropane]-1'-amine?
The canonical SMILES for spiro[1,2-dihydroindene-3,2'-cyclopropane]-1'-amine is NC1CC12CCc1ccccc12.
What is the InChIKey of spiro[1,2-dihydroindene-3,2'-cyclopropane]-1'-amine?
The InChIKey is SGGAHRNIDLQRJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N/c12-10-7-11(10)6-5-8-3-1-2-4-9(8)11/h1-4,10H,5-7,12H2.
What are the key properties of spiro[1,2-dihydroindene-3,2'-cyclopropane]-1'-amine?
spiro[1,2-dihydroindene-3,2'-cyclopropane]-1'-amine has a molecular weight of 159.23 g/mol, XLogP of 1.60, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[1,2-dihydroindene-3,2'-cyclopropane]-1'-amine is sourced from PubChem (CID 62388829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).