About 6-amino-2-(2-methoxyethyl)-1,1-dioxo-1,2-benzothiazol-3-one
6-amino-2-(2-methoxyethyl)-1,1-dioxo-1,2-benzothiazol-3-one (PubChem CID 62389705) has the molecular formula C10H12N2O4S
and a molecular weight of 256.28 g/mol. Its IUPAC name is 6-amino-2-(2-methoxyethyl)-1,1-dioxo-1,2-benzothiazol-3-one.
Molecular Properties
| Compound Name | 6-amino-2-(2-methoxyethyl)-1,1-dioxo-1,2-benzothiazol-3-one |
| PubChem CID | 62389705 |
| Molecular Formula | C10H12N2O4S |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | 6-amino-2-(2-methoxyethyl)-1,1-dioxo-1,2-benzothiazol-3-one |
| SMILES | COCCN1C(=O)c2ccc(N)cc2S1(=O)=O |
| InChI | InChI=1S/C10H12N2O4S/c1-16-5-4-12-10(13)8-3-2-7(11)6-9(8)17(12,14)15/h2-3,6H,4-5,11H2,1H3 |
| InChIKey | MHCMWVJJKBILBE-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 6-amino-2-(2-methoxyethyl)-1,1-dioxo-1,2-benzothiazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-2-(2-methoxyethyl)-1,1-dioxo-1,2-benzothiazol-3-one?
The IUPAC name of 6-amino-2-(2-methoxyethyl)-1,1-dioxo-1,2-benzothiazol-3-one (CID 62389705) is 6-amino-2-(2-methoxyethyl)-1,1-dioxo-1,2-benzothiazol-3-one.
What is the SMILES notation for 6-amino-2-(2-methoxyethyl)-1,1-dioxo-1,2-benzothiazol-3-one?
The canonical SMILES for 6-amino-2-(2-methoxyethyl)-1,1-dioxo-1,2-benzothiazol-3-one is COCCN1C(=O)c2ccc(N)cc2S1(=O)=O.
What is the InChIKey of 6-amino-2-(2-methoxyethyl)-1,1-dioxo-1,2-benzothiazol-3-one?
The InChIKey is MHCMWVJJKBILBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O4S/c1-16-5-4-12-10(13)8-3-2-7(11)6-9(8)17(12,14)15/h2-3,6H,4-5,11H2,1H3.
What are the key properties of 6-amino-2-(2-methoxyethyl)-1,1-dioxo-1,2-benzothiazol-3-one?
6-amino-2-(2-methoxyethyl)-1,1-dioxo-1,2-benzothiazol-3-one has a molecular weight of 256.28 g/mol, XLogP of 0.06, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-2-(2-methoxyethyl)-1,1-dioxo-1,2-benzothiazol-3-one is sourced from PubChem (CID 62389705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).