About 6,6-dioxo-6λ6-thiaspiro[2.5]octane-2-carboxylic acid
6,6-dioxo-6λ6-thiaspiro[2.5]octane-2-carboxylic acid (PubChem CID 62389917) has the molecular formula C8H12O4S
and a molecular weight of 204.25 g/mol. Its IUPAC name is 6,6-dioxo-6λ6-thiaspiro[2.5]octane-2-carboxylic acid.
Molecular Properties
| Compound Name | 6,6-dioxo-6λ6-thiaspiro[2.5]octane-2-carboxylic acid |
| PubChem CID | 62389917 |
| Molecular Formula | C8H12O4S |
| Molecular Weight | 204.25 g/mol |
| Exact Mass | 204.05 |
| IUPAC Name | 6,6-dioxo-6λ6-thiaspiro[2.5]octane-2-carboxylic acid |
| SMILES | O=C(O)C1CC12CCS(=O)(=O)CC2 |
| InChI | InChI=1S/C8H12O4S/c9-7(10)6-5-8(6)1-3-13(11,12)4-2-8/h6H,1-5H2,(H,9,10) |
| InChIKey | LDKARROWWIBGLE-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.25 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6,6-dioxo-6λ6-thiaspiro[2.5]octane-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,6-dioxo-6λ6-thiaspiro[2.5]octane-2-carboxylic acid?
The IUPAC name of 6,6-dioxo-6λ6-thiaspiro[2.5]octane-2-carboxylic acid (CID 62389917) is 6,6-dioxo-6λ6-thiaspiro[2.5]octane-2-carboxylic acid.
What is the SMILES notation for 6,6-dioxo-6λ6-thiaspiro[2.5]octane-2-carboxylic acid?
The canonical SMILES for 6,6-dioxo-6λ6-thiaspiro[2.5]octane-2-carboxylic acid is O=C(O)C1CC12CCS(=O)(=O)CC2.
What is the InChIKey of 6,6-dioxo-6λ6-thiaspiro[2.5]octane-2-carboxylic acid?
The InChIKey is LDKARROWWIBGLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O4S/c9-7(10)6-5-8(6)1-3-13(11,12)4-2-8/h6H,1-5H2,(H,9,10).
What are the key properties of 6,6-dioxo-6λ6-thiaspiro[2.5]octane-2-carboxylic acid?
6,6-dioxo-6λ6-thiaspiro[2.5]octane-2-carboxylic acid has a molecular weight of 204.25 g/mol, XLogP of 0.29, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,6-dioxo-6λ6-thiaspiro[2.5]octane-2-carboxylic acid is sourced from PubChem (CID 62389917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).