C16H23NO2 — CID 62390031
7-but-3-en-2-yloxy-N,2,2-trimethyl-3,4-dihydrochromen-4-amine (PubChem CID 62390031) has the molecular formula C16H23NO2 and a molecular weight of 261.37 g/mol. Its IUPAC name is 7-but-3-en-2-yloxy-N,2,2-trimethyl-3,4-dihydrochromen-4-amine.
| Compound Name | 7-but-3-en-2-yloxy-N,2,2-trimethyl-3,4-dihydrochromen-4-amine |
|---|---|
| PubChem CID | 62390031 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | 7-but-3-en-2-yloxy-N,2,2-trimethyl-3,4-dihydrochromen-4-amine |
| SMILES | C=CC(C)Oc1ccc2c(c1)OC(C)(C)CC2NC |
| InChI | InChI=1S/C16H23NO2/c1-6-11(2)18-12-7-8-13-14(17-5)10-16(3,4)19-15(13)9-12/h6-9,11,14,17H,1,10H2,2-5H3 |
| InChIKey | CVZLIXITGLCAOF-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|