About N-[[4-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]oxan-4-yl]methyl]-2-methylpropan-1-amine
N-[[4-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]oxan-4-yl]methyl]-2-methylpropan-1-amine (PubChem CID 62391149) has the molecular formula C15H29F3N2O
and a molecular weight of 310.40 g/mol. Its IUPAC name is N-[[4-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]oxan-4-yl]methyl]-2-methylpropan-1-amine.
Molecular Properties
| Compound Name | N-[[4-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]oxan-4-yl]methyl]-2-methylpropan-1-amine |
| PubChem CID | 62391149 |
| Molecular Formula | C15H29F3N2O |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.22 |
| IUPAC Name | N-[[4-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]oxan-4-yl]methyl]-2-methylpropan-1-amine |
| SMILES | CCN(CC(F)(F)F)CC1(CNCC(C)C)CCOCC1 |
| InChI | InChI=1S/C15H29F3N2O/c1-4-20(12-15(16,17)18)11-14(5-7-21-8-6-14)10-19-9-13(2)3/h13,19H,4-12H2,1-3H3 |
| InChIKey | CHZAIMFYWOGSBG-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[[4-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]oxan-4-yl]methyl]-2-methylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[4-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]oxan-4-yl]methyl]-2-methylpropan-1-amine?
The IUPAC name of N-[[4-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]oxan-4-yl]methyl]-2-methylpropan-1-amine (CID 62391149) is N-[[4-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]oxan-4-yl]methyl]-2-methylpropan-1-amine.
What is the SMILES notation for N-[[4-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]oxan-4-yl]methyl]-2-methylpropan-1-amine?
The canonical SMILES for N-[[4-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]oxan-4-yl]methyl]-2-methylpropan-1-amine is CCN(CC(F)(F)F)CC1(CNCC(C)C)CCOCC1.
What is the InChIKey of N-[[4-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]oxan-4-yl]methyl]-2-methylpropan-1-amine?
The InChIKey is CHZAIMFYWOGSBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H29F3N2O/c1-4-20(12-15(16,17)18)11-14(5-7-21-8-6-14)10-19-9-13(2)3/h13,19H,4-12H2,1-3H3.
What are the key properties of N-[[4-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]oxan-4-yl]methyl]-2-methylpropan-1-amine?
N-[[4-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]oxan-4-yl]methyl]-2-methylpropan-1-amine has a molecular weight of 310.40 g/mol, XLogP of 2.91, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[4-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]oxan-4-yl]methyl]-2-methylpropan-1-amine is sourced from PubChem (CID 62391149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).