C15H26N2O2 — CID 62391166
N-[[4-[[furan-3-ylmethyl(methyl)amino]methyl]oxan-4-yl]methyl]ethanamine (PubChem CID 62391166) has the molecular formula C15H26N2O2 and a molecular weight of 266.38 g/mol. Its IUPAC name is N-[[4-[[furan-3-ylmethyl(methyl)amino]methyl]oxan-4-yl]methyl]ethanamine.
| Compound Name | N-[[4-[[furan-3-ylmethyl(methyl)amino]methyl]oxan-4-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 62391166 |
| Molecular Formula | C15H26N2O2 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.20 |
| IUPAC Name | N-[[4-[[furan-3-ylmethyl(methyl)amino]methyl]oxan-4-yl]methyl]ethanamine |
| SMILES | CCNCC1(CN(C)Cc2ccoc2)CCOCC1 |
| InChI | InChI=1S/C15H26N2O2/c1-3-16-12-15(5-8-18-9-6-15)13-17(2)10-14-4-7-19-11-14/h4,7,11,16H,3,5-6,8-10,12-13H2,1-2H3 |
| InChIKey | BVYHKXOOKAUWMJ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 37.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |