C16H31N3O2 — CID 62391797
2-[4-[[4-[(cyclopropylamino)methyl]oxan-4-yl]methyl]piperazin-1-yl]ethanol (PubChem CID 62391797) has the molecular formula C16H31N3O2 and a molecular weight of 297.44 g/mol. Its IUPAC name is 2-[4-[[4-[(cyclopropylamino)methyl]oxan-4-yl]methyl]piperazin-1-yl]ethanol.
| Compound Name | 2-[4-[[4-[(cyclopropylamino)methyl]oxan-4-yl]methyl]piperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 62391797 |
| Molecular Formula | C16H31N3O2 |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.24 |
| IUPAC Name | 2-[4-[[4-[(cyclopropylamino)methyl]oxan-4-yl]methyl]piperazin-1-yl]ethanol |
| SMILES | OCCN1CCN(CC2(CNC3CC3)CCOCC2)CC1 |
| InChI | InChI=1S/C16H31N3O2/c20-10-9-18-5-7-19(8-6-18)14-16(3-11-21-12-4-16)13-17-15-1-2-15/h15,17,20H,1-14H2 |
| InChIKey | ZCIHRUQVAPOJEV-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 47.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |