C16H27BrN2OS — CID 62392031
N-[[4-[[(4-bromothiophen-2-yl)methyl-methylamino]methyl]oxan-4-yl]methyl]propan-2-amine (PubChem CID 62392031) has the molecular formula C16H27BrN2OS and a molecular weight of 375.38 g/mol. Its IUPAC name is N-[[4-[[(4-bromothiophen-2-yl)methyl-methylamino]methyl]oxan-4-yl]methyl]propan-2-amine.
| Compound Name | N-[[4-[[(4-bromothiophen-2-yl)methyl-methylamino]methyl]oxan-4-yl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 62392031 |
| Molecular Formula | C16H27BrN2OS |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | N-[[4-[[(4-bromothiophen-2-yl)methyl-methylamino]methyl]oxan-4-yl]methyl]propan-2-amine |
| SMILES | CC(C)NCC1(CN(C)Cc2cc(Br)cs2)CCOCC1 |
| InChI | InChI=1S/C16H27BrN2OS/c1-13(2)18-11-16(4-6-20-7-5-16)12-19(3)9-15-8-14(17)10-21-15/h8,10,13,18H,4-7,9,11-12H2,1-3H3 |
| InChIKey | GGYADHHPIVZQEN-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |