C16H25BrN2O2 — CID 62392946
2-[4-bromo-2-[1-(ethylamino)ethyl]phenoxy]-N-propylpropanamide (PubChem CID 62392946) has the molecular formula C16H25BrN2O2 and a molecular weight of 357.29 g/mol. Its IUPAC name is 2-[4-bromo-2-[1-(ethylamino)ethyl]phenoxy]-N-propylpropanamide.
| Compound Name | 2-[4-bromo-2-[1-(ethylamino)ethyl]phenoxy]-N-propylpropanamide |
|---|---|
| PubChem CID | 62392946 |
| Molecular Formula | C16H25BrN2O2 |
| Molecular Weight | 357.29 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | 2-[4-bromo-2-[1-(ethylamino)ethyl]phenoxy]-N-propylpropanamide |
| SMILES | CCCNC(=O)C(C)Oc1ccc(Br)cc1C(C)NCC |
| InChI | InChI=1S/C16H25BrN2O2/c1-5-9-19-16(20)12(4)21-15-8-7-13(17)10-14(15)11(3)18-6-2/h7-8,10-12,18H,5-6,9H2,1-4H3,(H,19,20) |
| InChIKey | PKRFKLJFDHLJNP-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.29 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |