About 4,8-dimethylnaphtho[2,1-f][1]benzofuran-7,11-dione
4,8-dimethylnaphtho[2,1-f][1]benzofuran-7,11-dione (PubChem CID 623940) has the molecular formula C18H12O3
and a molecular weight of 276.29 g/mol. Its IUPAC name is 4,8-dimethylnaphtho[2,1-f][1]benzofuran-7,11-dione.
Molecular Properties
| Compound Name | 4,8-dimethylnaphtho[2,1-f][1]benzofuran-7,11-dione |
| PubChem CID | 623940 |
| Molecular Formula | C18H12O3 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | 4,8-dimethylnaphtho[2,1-f][1]benzofuran-7,11-dione |
| SMILES | Cc1coc2c1C(=O)c1ccc3c(C)cccc3c1C2=O |
| InChI | InChI=1S/C18H12O3/c1-9-4-3-5-12-11(9)6-7-13-15(12)17(20)18-14(16(13)19)10(2)8-21-18/h3-8H,1-2H3 |
| InChIKey | XYKZSUXWBGUGQV-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze 4,8-dimethylnaphtho[2,1-f][1]benzofuran-7,11-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,8-dimethylnaphtho[2,1-f][1]benzofuran-7,11-dione?
The IUPAC name of 4,8-dimethylnaphtho[2,1-f][1]benzofuran-7,11-dione (CID 623940) is 4,8-dimethylnaphtho[2,1-f][1]benzofuran-7,11-dione.
What is the SMILES notation for 4,8-dimethylnaphtho[2,1-f][1]benzofuran-7,11-dione?
The canonical SMILES for 4,8-dimethylnaphtho[2,1-f][1]benzofuran-7,11-dione is Cc1coc2c1C(=O)c1ccc3c(C)cccc3c1C2=O.
What is the InChIKey of 4,8-dimethylnaphtho[2,1-f][1]benzofuran-7,11-dione?
The InChIKey is XYKZSUXWBGUGQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12O3/c1-9-4-3-5-12-11(9)6-7-13-15(12)17(20)18-14(16(13)19)10(2)8-21-18/h3-8H,1-2H3.
What are the key properties of 4,8-dimethylnaphtho[2,1-f][1]benzofuran-7,11-dione?
4,8-dimethylnaphtho[2,1-f][1]benzofuran-7,11-dione has a molecular weight of 276.29 g/mol, XLogP of 3.83, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,8-dimethylnaphtho[2,1-f][1]benzofuran-7,11-dione is sourced from PubChem (CID 623940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).