C14H28N2O6 — CID 623957
2-(1,4,7,10,13-pentaoxa-16-azacyclooctadec-16-yl)acetamide (PubChem CID 623957) has the molecular formula C14H28N2O6 and a molecular weight of 320.39 g/mol. Its IUPAC name is 2-(1,4,7,10,13-pentaoxa-16-azacyclooctadec-16-yl)acetamide.
| Compound Name | 2-(1,4,7,10,13-pentaoxa-16-azacyclooctadec-16-yl)acetamide |
|---|---|
| PubChem CID | 623957 |
| Molecular Formula | C14H28N2O6 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | 2-(1,4,7,10,13-pentaoxa-16-azacyclooctadec-16-yl)acetamide |
| SMILES | NC(=O)CN1CCOCCOCCOCCOCCOCC1 |
| InChI | InChI=1S/C14H28N2O6/c15-14(17)13-16-1-3-18-5-7-20-9-11-22-12-10-21-8-6-19-4-2-16/h1-13H2,(H2,15,17) |
| InChIKey | IDTAFJDKZFOCOY-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 92.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |