2-[(3,5-dimethylphenyl)-hydroxymethyl]butanoic acid

C13H18O3 — CID 62396252

IUPAC2-[(3,5-dimethylphenyl)-hydroxymethyl]butanoic acid
SMILESCCC(C(=O)O)C(O)c1cc(C)cc(C)c1
InChIInChI=1S/C13H18O3/c1-4-11(13(15)16)12(14)10-6-8(2)5-9(3)7-10/h5-7,11-12,14H,4H2,1-3H3,(H,15,16)
InChIKeyYWMCCMNAFAIIIK-UHFFFAOYSA-N
MW222.28 g/mol
LogP2.45
Rot. Bonds4

About 2-[(3,5-dimethylphenyl)-hydroxymethyl]butanoic acid

2-[(3,5-dimethylphenyl)-hydroxymethyl]butanoic acid (PubChem CID 62396252) has the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. Its IUPAC name is 2-[(3,5-dimethylphenyl)-hydroxymethyl]butanoic acid.

Molecular Properties

Compound Name2-[(3,5-dimethylphenyl)-hydroxymethyl]butanoic acid
PubChem CID62396252
Molecular FormulaC13H18O3
Molecular Weight222.28 g/mol
Exact Mass222.13
IUPAC Name2-[(3,5-dimethylphenyl)-hydroxymethyl]butanoic acid
SMILESCCC(C(=O)O)C(O)c1cc(C)cc(C)c1
InChIInChI=1S/C13H18O3/c1-4-11(13(15)16)12(14)10-6-8(2)5-9(3)7-10/h5-7,11-12,14H,4H2,1-3H3,(H,15,16)
InChIKeyYWMCCMNAFAIIIK-UHFFFAOYSA-N
XLogP2.45
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500222.28
LogP ≤ 52.45
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-[(3,5-dimethylphenyl)-hydroxymethyl]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(3,5-dimethylphenyl)-hydroxymethyl]butanoic acid?
The IUPAC name of 2-[(3,5-dimethylphenyl)-hydroxymethyl]butanoic acid (CID 62396252) is 2-[(3,5-dimethylphenyl)-hydroxymethyl]butanoic acid.
What is the SMILES notation for 2-[(3,5-dimethylphenyl)-hydroxymethyl]butanoic acid?
The canonical SMILES for 2-[(3,5-dimethylphenyl)-hydroxymethyl]butanoic acid is CCC(C(=O)O)C(O)c1cc(C)cc(C)c1.
What is the InChIKey of 2-[(3,5-dimethylphenyl)-hydroxymethyl]butanoic acid?
The InChIKey is YWMCCMNAFAIIIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O3/c1-4-11(13(15)16)12(14)10-6-8(2)5-9(3)7-10/h5-7,11-12,14H,4H2,1-3H3,(H,15,16).
What are the key properties of 2-[(3,5-dimethylphenyl)-hydroxymethyl]butanoic acid?
2-[(3,5-dimethylphenyl)-hydroxymethyl]butanoic acid has a molecular weight of 222.28 g/mol, XLogP of 2.45, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3,5-dimethylphenyl)-hydroxymethyl]butanoic acid is sourced from PubChem (CID 62396252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).