C10H16F2O4 — CID 62396778
ethyl 2,2-difluoro-3-hydroxy-3-(oxan-4-yl)propanoate (PubChem CID 62396778) has the molecular formula C10H16F2O4 and a molecular weight of 238.23 g/mol. Its IUPAC name is ethyl 2,2-difluoro-3-hydroxy-3-(oxan-4-yl)propanoate.
| Compound Name | ethyl 2,2-difluoro-3-hydroxy-3-(oxan-4-yl)propanoate |
|---|---|
| PubChem CID | 62396778 |
| Molecular Formula | C10H16F2O4 |
| Molecular Weight | 238.23 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | ethyl 2,2-difluoro-3-hydroxy-3-(oxan-4-yl)propanoate |
| SMILES | CCOC(=O)C(F)(F)C(O)C1CCOCC1 |
| InChI | InChI=1S/C10H16F2O4/c1-2-16-9(14)10(11,12)8(13)7-3-5-15-6-4-7/h7-8,13H,2-6H2,1H3 |
| InChIKey | TVLIDLMBYRJHFK-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.23 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |