C12H13BrF2O3 — CID 62397381
ethyl 3-(4-bromophenyl)-2,2-difluoro-3-hydroxybutanoate (PubChem CID 62397381) has the molecular formula C12H13BrF2O3 and a molecular weight of 323.13 g/mol. Its IUPAC name is ethyl 3-(4-bromophenyl)-2,2-difluoro-3-hydroxybutanoate.
| Compound Name | ethyl 3-(4-bromophenyl)-2,2-difluoro-3-hydroxybutanoate |
|---|---|
| PubChem CID | 62397381 |
| Molecular Formula | C12H13BrF2O3 |
| Molecular Weight | 323.13 g/mol |
| Exact Mass | 322.00 |
| IUPAC Name | ethyl 3-(4-bromophenyl)-2,2-difluoro-3-hydroxybutanoate |
| SMILES | CCOC(=O)C(F)(F)C(C)(O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C12H13BrF2O3/c1-3-18-10(16)12(14,15)11(2,17)8-4-6-9(13)7-5-8/h4-7,17H,3H2,1-2H3 |
| InChIKey | YFUCOLKZPNWGMB-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.13 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |