C11H13BrFN — CID 62397492
N-[(3-bromo-4-fluorophenyl)methyl]-2-methylcyclopropan-1-amine (PubChem CID 62397492) has the molecular formula C11H13BrFN and a molecular weight of 258.13 g/mol. Its IUPAC name is N-[(3-bromo-4-fluorophenyl)methyl]-2-methylcyclopropan-1-amine.
| Compound Name | N-[(3-bromo-4-fluorophenyl)methyl]-2-methylcyclopropan-1-amine |
|---|---|
| PubChem CID | 62397492 |
| Molecular Formula | C11H13BrFN |
| Molecular Weight | 258.13 g/mol |
| Exact Mass | 257.02 |
| IUPAC Name | N-[(3-bromo-4-fluorophenyl)methyl]-2-methylcyclopropan-1-amine |
| SMILES | CC1CC1NCc1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C11H13BrFN/c1-7-4-11(7)14-6-8-2-3-10(13)9(12)5-8/h2-3,5,7,11,14H,4,6H2,1H3 |
| InChIKey | DMLJREYZKYDIJG-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.13 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |