C15H14ClNO3 — CID 623984
7-chloro-10-hydroxy-3,3-dimethyl-2,4-dihydroacridine-1,9-dione (PubChem CID 623984) has the molecular formula C15H14ClNO3 and a molecular weight of 291.73 g/mol. Its IUPAC name is 7-chloro-10-hydroxy-3,3-dimethyl-2,4-dihydroacridine-1,9-dione.
| Compound Name | 7-chloro-10-hydroxy-3,3-dimethyl-2,4-dihydroacridine-1,9-dione |
|---|---|
| PubChem CID | 623984 |
| Molecular Formula | C15H14ClNO3 |
| Molecular Weight | 291.73 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | 7-chloro-10-hydroxy-3,3-dimethyl-2,4-dihydroacridine-1,9-dione |
| SMILES | CC1(C)CC(=O)c2c(n(O)c3ccc(Cl)cc3c2=O)C1 |
| InChI | InChI=1S/C15H14ClNO3/c1-15(2)6-11-13(12(18)7-15)14(19)9-5-8(16)3-4-10(9)17(11)20/h3-5,20H,6-7H2,1-2H3 |
| InChIKey | LMJZOAJRUBOKRC-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.73 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|