C11H13N3O — CID 62399389
[1-(3,4-dimethylphenyl)triazol-4-yl]methanol (PubChem CID 62399389) has the molecular formula C11H13N3O and a molecular weight of 203.24 g/mol. Its IUPAC name is [1-(3,4-dimethylphenyl)triazol-4-yl]methanol.
| Compound Name | [1-(3,4-dimethylphenyl)triazol-4-yl]methanol |
|---|---|
| PubChem CID | 62399389 |
| Molecular Formula | C11H13N3O |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | [1-(3,4-dimethylphenyl)triazol-4-yl]methanol |
| SMILES | Cc1ccc(-n2cc(CO)nn2)cc1C |
| InChI | InChI=1S/C11H13N3O/c1-8-3-4-11(5-9(8)2)14-6-10(7-15)12-13-14/h3-6,15H,7H2,1-2H3 |
| InChIKey | COCVVHVFRCTWBH-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |