C8H11ClN6 — CID 62399523
3-[[4-(chloromethyl)triazol-1-yl]methyl]-4,5-dimethyl-1,2,4-triazole (PubChem CID 62399523) has the molecular formula C8H11ClN6 and a molecular weight of 226.67 g/mol. Its IUPAC name is 3-[[4-(chloromethyl)triazol-1-yl]methyl]-4,5-dimethyl-1,2,4-triazole.
| Compound Name | 3-[[4-(chloromethyl)triazol-1-yl]methyl]-4,5-dimethyl-1,2,4-triazole |
|---|---|
| PubChem CID | 62399523 |
| Molecular Formula | C8H11ClN6 |
| Molecular Weight | 226.67 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | 3-[[4-(chloromethyl)triazol-1-yl]methyl]-4,5-dimethyl-1,2,4-triazole |
| SMILES | Cc1nnc(Cn2cc(CCl)nn2)n1C |
| InChI | InChI=1S/C8H11ClN6/c1-6-10-12-8(14(6)2)5-15-4-7(3-9)11-13-15/h4H,3,5H2,1-2H3 |
| InChIKey | LYAIBFDFYNKNGV-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.67 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|