C8Cl10 — CID 623996
1,2,4,5-tetrachloro-3,6-bis(trichloromethyl)benzene (PubChem CID 623996) has the molecular formula C8Cl10 and a molecular weight of 450.62 g/mol. Its IUPAC name is 1,2,4,5-tetrachloro-3,6-bis(trichloromethyl)benzene.
| Compound Name | 1,2,4,5-tetrachloro-3,6-bis(trichloromethyl)benzene |
|---|---|
| PubChem CID | 623996 |
| Molecular Formula | C8Cl10 |
| Molecular Weight | 450.62 g/mol |
| Exact Mass | 445.69 |
| IUPAC Name | 1,2,4,5-tetrachloro-3,6-bis(trichloromethyl)benzene |
| SMILES | Clc1c(Cl)c(C(Cl)(Cl)Cl)c(Cl)c(Cl)c1C(Cl)(Cl)Cl |
| InChI | InChI=1S/C8Cl10/c9-3-1(7(13,14)15)4(10)6(12)2(5(3)11)8(16,17)18 |
| InChIKey | DTOMKKRROVKOGE-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.62 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|