About 4-(chloromethyl)-1-(2,2-difluoroethyl)triazole
4-(chloromethyl)-1-(2,2-difluoroethyl)triazole (PubChem CID 62399711) has the molecular formula C5H6ClF2N3
and a molecular weight of 181.57 g/mol. Its IUPAC name is 4-(chloromethyl)-1-(2,2-difluoroethyl)triazole.
Molecular Properties
| Compound Name | 4-(chloromethyl)-1-(2,2-difluoroethyl)triazole |
| PubChem CID | 62399711 |
| Molecular Formula | C5H6ClF2N3 |
| Molecular Weight | 181.57 g/mol |
| Exact Mass | 181.02 |
| IUPAC Name | 4-(chloromethyl)-1-(2,2-difluoroethyl)triazole |
| SMILES | FC(F)Cn1cc(CCl)nn1 |
| InChI | InChI=1S/C5H6ClF2N3/c6-1-4-2-11(10-9-4)3-5(7)8/h2,5H,1,3H2 |
| InChIKey | WVZNGWFLLMEWMD-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.57 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(chloromethyl)-1-(2,2-difluoroethyl)triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(chloromethyl)-1-(2,2-difluoroethyl)triazole?
The IUPAC name of 4-(chloromethyl)-1-(2,2-difluoroethyl)triazole (CID 62399711) is 4-(chloromethyl)-1-(2,2-difluoroethyl)triazole.
What is the SMILES notation for 4-(chloromethyl)-1-(2,2-difluoroethyl)triazole?
The canonical SMILES for 4-(chloromethyl)-1-(2,2-difluoroethyl)triazole is FC(F)Cn1cc(CCl)nn1.
What is the InChIKey of 4-(chloromethyl)-1-(2,2-difluoroethyl)triazole?
The InChIKey is WVZNGWFLLMEWMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6ClF2N3/c6-1-4-2-11(10-9-4)3-5(7)8/h2,5H,1,3H2.
What are the key properties of 4-(chloromethyl)-1-(2,2-difluoroethyl)triazole?
4-(chloromethyl)-1-(2,2-difluoroethyl)triazole has a molecular weight of 181.57 g/mol, XLogP of 1.28, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(chloromethyl)-1-(2,2-difluoroethyl)triazole is sourced from PubChem (CID 62399711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).