About 5-[[4-(2-hydroxyethyl)triazol-1-yl]methyl]-1,3-oxazolidin-2-one
5-[[4-(2-hydroxyethyl)triazol-1-yl]methyl]-1,3-oxazolidin-2-one (PubChem CID 62400194) has the molecular formula C8H12N4O3
and a molecular weight of 212.21 g/mol. Its IUPAC name is 5-[[4-(2-hydroxyethyl)triazol-1-yl]methyl]-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | 5-[[4-(2-hydroxyethyl)triazol-1-yl]methyl]-1,3-oxazolidin-2-one |
| PubChem CID | 62400194 |
| Molecular Formula | C8H12N4O3 |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | 5-[[4-(2-hydroxyethyl)triazol-1-yl]methyl]-1,3-oxazolidin-2-one |
| SMILES | O=C1NCC(Cn2cc(CCO)nn2)O1 |
| InChI | InChI=1S/C8H12N4O3/c13-2-1-6-4-12(11-10-6)5-7-3-9-8(14)15-7/h4,7,13H,1-3,5H2,(H,9,14) |
| InChIKey | HHSHREMCRJPQGW-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[[4-(2-hydroxyethyl)triazol-1-yl]methyl]-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[4-(2-hydroxyethyl)triazol-1-yl]methyl]-1,3-oxazolidin-2-one?
The IUPAC name of 5-[[4-(2-hydroxyethyl)triazol-1-yl]methyl]-1,3-oxazolidin-2-one (CID 62400194) is 5-[[4-(2-hydroxyethyl)triazol-1-yl]methyl]-1,3-oxazolidin-2-one.
What is the SMILES notation for 5-[[4-(2-hydroxyethyl)triazol-1-yl]methyl]-1,3-oxazolidin-2-one?
The canonical SMILES for 5-[[4-(2-hydroxyethyl)triazol-1-yl]methyl]-1,3-oxazolidin-2-one is O=C1NCC(Cn2cc(CCO)nn2)O1.
What is the InChIKey of 5-[[4-(2-hydroxyethyl)triazol-1-yl]methyl]-1,3-oxazolidin-2-one?
The InChIKey is HHSHREMCRJPQGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N4O3/c13-2-1-6-4-12(11-10-6)5-7-3-9-8(14)15-7/h4,7,13H,1-3,5H2,(H,9,14).
What are the key properties of 5-[[4-(2-hydroxyethyl)triazol-1-yl]methyl]-1,3-oxazolidin-2-one?
5-[[4-(2-hydroxyethyl)triazol-1-yl]methyl]-1,3-oxazolidin-2-one has a molecular weight of 212.21 g/mol, XLogP of -1.08, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[4-(2-hydroxyethyl)triazol-1-yl]methyl]-1,3-oxazolidin-2-one is sourced from PubChem (CID 62400194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).