C12H12F3N3OS — CID 62400741
[1-[2-[3-(trifluoromethyl)phenyl]sulfanylethyl]triazol-4-yl]methanol (PubChem CID 62400741) has the molecular formula C12H12F3N3OS and a molecular weight of 303.31 g/mol. Its IUPAC name is [1-[2-[3-(trifluoromethyl)phenyl]sulfanylethyl]triazol-4-yl]methanol.
| Compound Name | [1-[2-[3-(trifluoromethyl)phenyl]sulfanylethyl]triazol-4-yl]methanol |
|---|---|
| PubChem CID | 62400741 |
| Molecular Formula | C12H12F3N3OS |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | [1-[2-[3-(trifluoromethyl)phenyl]sulfanylethyl]triazol-4-yl]methanol |
| SMILES | OCc1cn(CCSc2cccc(C(F)(F)F)c2)nn1 |
| InChI | InChI=1S/C12H12F3N3OS/c13-12(14,15)9-2-1-3-11(6-9)20-5-4-18-7-10(8-19)16-17-18/h1-3,6-7,19H,4-5,8H2 |
| InChIKey | DXNRKPUYTQCOOU-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |