C13H15ClN4O2 — CID 62400746
N-[(3-chlorophenyl)methyl]-2-[4-(hydroxymethyl)triazol-1-yl]-N-methylacetamide (PubChem CID 62400746) has the molecular formula C13H15ClN4O2 and a molecular weight of 294.74 g/mol. Its IUPAC name is N-[(3-chlorophenyl)methyl]-2-[4-(hydroxymethyl)triazol-1-yl]-N-methylacetamide.
| Compound Name | N-[(3-chlorophenyl)methyl]-2-[4-(hydroxymethyl)triazol-1-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 62400746 |
| Molecular Formula | C13H15ClN4O2 |
| Molecular Weight | 294.74 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | N-[(3-chlorophenyl)methyl]-2-[4-(hydroxymethyl)triazol-1-yl]-N-methylacetamide |
| SMILES | CN(Cc1cccc(Cl)c1)C(=O)Cn1cc(CO)nn1 |
| InChI | InChI=1S/C13H15ClN4O2/c1-17(6-10-3-2-4-11(14)5-10)13(20)8-18-7-12(9-19)15-16-18/h2-5,7,19H,6,8-9H2,1H3 |
| InChIKey | FYJZYGQHJSPTBX-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.74 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |