C10H28O2Si4 — CID 624008
2,2,4,4,6,6,8,8-octamethyl-1,5,2,4,6,8-dioxatetrasilocane (PubChem CID 624008) has the molecular formula C10H28O2Si4 and a molecular weight of 292.68 g/mol. Its IUPAC name is 2,2,4,4,6,6,8,8-octamethyl-1,5,2,4,6,8-dioxatetrasilocane.
| Compound Name | 2,2,4,4,6,6,8,8-octamethyl-1,5,2,4,6,8-dioxatetrasilocane |
|---|---|
| PubChem CID | 624008 |
| Molecular Formula | C10H28O2Si4 |
| Molecular Weight | 292.68 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 2,2,4,4,6,6,8,8-octamethyl-1,5,2,4,6,8-dioxatetrasilocane |
| SMILES | C[Si]1(C)C[Si](C)(C)O[Si](C)(C)C[Si](C)(C)O1 |
| InChI | InChI=1S/C10H28O2Si4/c1-13(2)9-14(3,4)12-16(7,8)10-15(5,6)11-13/h9-10H2,1-8H3 |
| InChIKey | BKJGWMLFLSBAHC-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.68 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|