About [1-[(2-thiophen-3-yl-1,3-thiazol-4-yl)methyl]triazol-4-yl]methanol
[1-[(2-thiophen-3-yl-1,3-thiazol-4-yl)methyl]triazol-4-yl]methanol (PubChem CID 62400918) has the molecular formula C11H10N4OS2
and a molecular weight of 278.36 g/mol. Its IUPAC name is [1-[(2-thiophen-3-yl-1,3-thiazol-4-yl)methyl]triazol-4-yl]methanol.
Molecular Properties
| Compound Name | [1-[(2-thiophen-3-yl-1,3-thiazol-4-yl)methyl]triazol-4-yl]methanol |
| PubChem CID | 62400918 |
| Molecular Formula | C11H10N4OS2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.03 |
| IUPAC Name | [1-[(2-thiophen-3-yl-1,3-thiazol-4-yl)methyl]triazol-4-yl]methanol |
| SMILES | OCc1cn(Cc2csc(-c3ccsc3)n2)nn1 |
| InChI | InChI=1S/C11H10N4OS2/c16-5-9-3-15(14-13-9)4-10-7-18-11(12-10)8-1-2-17-6-8/h1-3,6-7,16H,4-5H2 |
| InChIKey | AJEHCOGHLGCHSE-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [1-[(2-thiophen-3-yl-1,3-thiazol-4-yl)methyl]triazol-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(2-thiophen-3-yl-1,3-thiazol-4-yl)methyl]triazol-4-yl]methanol?
The IUPAC name of [1-[(2-thiophen-3-yl-1,3-thiazol-4-yl)methyl]triazol-4-yl]methanol (CID 62400918) is [1-[(2-thiophen-3-yl-1,3-thiazol-4-yl)methyl]triazol-4-yl]methanol.
What is the SMILES notation for [1-[(2-thiophen-3-yl-1,3-thiazol-4-yl)methyl]triazol-4-yl]methanol?
The canonical SMILES for [1-[(2-thiophen-3-yl-1,3-thiazol-4-yl)methyl]triazol-4-yl]methanol is OCc1cn(Cc2csc(-c3ccsc3)n2)nn1.
What is the InChIKey of [1-[(2-thiophen-3-yl-1,3-thiazol-4-yl)methyl]triazol-4-yl]methanol?
The InChIKey is AJEHCOGHLGCHSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N4OS2/c16-5-9-3-15(14-13-9)4-10-7-18-11(12-10)8-1-2-17-6-8/h1-3,6-7,16H,4-5H2.
What are the key properties of [1-[(2-thiophen-3-yl-1,3-thiazol-4-yl)methyl]triazol-4-yl]methanol?
[1-[(2-thiophen-3-yl-1,3-thiazol-4-yl)methyl]triazol-4-yl]methanol has a molecular weight of 278.36 g/mol, XLogP of 2.00, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(2-thiophen-3-yl-1,3-thiazol-4-yl)methyl]triazol-4-yl]methanol is sourced from PubChem (CID 62400918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).