C9H13ClN6 — CID 62401219
3-[[4-(2-chloroethyl)triazol-1-yl]methyl]-4,5-dimethyl-1,2,4-triazole (PubChem CID 62401219) has the molecular formula C9H13ClN6 and a molecular weight of 240.70 g/mol. Its IUPAC name is 3-[[4-(2-chloroethyl)triazol-1-yl]methyl]-4,5-dimethyl-1,2,4-triazole.
| Compound Name | 3-[[4-(2-chloroethyl)triazol-1-yl]methyl]-4,5-dimethyl-1,2,4-triazole |
|---|---|
| PubChem CID | 62401219 |
| Molecular Formula | C9H13ClN6 |
| Molecular Weight | 240.70 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 3-[[4-(2-chloroethyl)triazol-1-yl]methyl]-4,5-dimethyl-1,2,4-triazole |
| SMILES | Cc1nnc(Cn2cc(CCCl)nn2)n1C |
| InChI | InChI=1S/C9H13ClN6/c1-7-11-13-9(15(7)2)6-16-5-8(3-4-10)12-14-16/h5H,3-4,6H2,1-2H3 |
| InChIKey | KETCKBXZBDIFRB-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.70 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|