About 4-(2-chloroethyl)-1-(2,2-difluoroethyl)triazole
4-(2-chloroethyl)-1-(2,2-difluoroethyl)triazole (PubChem CID 62401424) has the molecular formula C6H8ClF2N3
and a molecular weight of 195.60 g/mol. Its IUPAC name is 4-(2-chloroethyl)-1-(2,2-difluoroethyl)triazole.
Molecular Properties
| Compound Name | 4-(2-chloroethyl)-1-(2,2-difluoroethyl)triazole |
| PubChem CID | 62401424 |
| Molecular Formula | C6H8ClF2N3 |
| Molecular Weight | 195.60 g/mol |
| Exact Mass | 195.04 |
| IUPAC Name | 4-(2-chloroethyl)-1-(2,2-difluoroethyl)triazole |
| SMILES | FC(F)Cn1cc(CCCl)nn1 |
| InChI | InChI=1S/C6H8ClF2N3/c7-2-1-5-3-12(11-10-5)4-6(8)9/h3,6H,1-2,4H2 |
| InChIKey | JVZUYTPYNNFXSW-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.60 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-chloroethyl)-1-(2,2-difluoroethyl)triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-chloroethyl)-1-(2,2-difluoroethyl)triazole?
The IUPAC name of 4-(2-chloroethyl)-1-(2,2-difluoroethyl)triazole (CID 62401424) is 4-(2-chloroethyl)-1-(2,2-difluoroethyl)triazole.
What is the SMILES notation for 4-(2-chloroethyl)-1-(2,2-difluoroethyl)triazole?
The canonical SMILES for 4-(2-chloroethyl)-1-(2,2-difluoroethyl)triazole is FC(F)Cn1cc(CCCl)nn1.
What is the InChIKey of 4-(2-chloroethyl)-1-(2,2-difluoroethyl)triazole?
The InChIKey is JVZUYTPYNNFXSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8ClF2N3/c7-2-1-5-3-12(11-10-5)4-6(8)9/h3,6H,1-2,4H2.
What are the key properties of 4-(2-chloroethyl)-1-(2,2-difluoroethyl)triazole?
4-(2-chloroethyl)-1-(2,2-difluoroethyl)triazole has a molecular weight of 195.60 g/mol, XLogP of 1.32, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-chloroethyl)-1-(2,2-difluoroethyl)triazole is sourced from PubChem (CID 62401424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).